C7H8O3 — CID 12701298
(1S,2S,4R,6S)-3,7-dioxatricyclo[4.3.0.02,4]nonan-8-one (PubChem CID 12701298) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is (1S,2S,4R,6S)-3,7-dioxatricyclo[4.3.0.02,4]nonan-8-one.
| Compound Name | (1S,2S,4R,6S)-3,7-dioxatricyclo[4.3.0.02,4]nonan-8-one |
|---|---|
| PubChem CID | 12701298 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (1S,2S,4R,6S)-3,7-dioxatricyclo[4.3.0.02,4]nonan-8-one |
| SMILES | O=C1C[C@@H]2[C@@H]3O[C@@H]3C[C@@H]2O1 |
| InChI | InChI=1S/C7H8O3/c8-6-1-3-4(9-6)2-5-7(3)10-5/h3-5,7H,1-2H2/t3-,4-,5+,7-/m0/s1 |
| InChIKey | MUIDESAARNCREM-HHJANIIPSA-N |
| XLogP | 0.09 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|