C11H21NO — CID 127013198
N-(2,5-dimethylcyclopentyl)oxolan-3-amine (PubChem CID 127013198) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is N-(2,5-dimethylcyclopentyl)oxolan-3-amine.
| Compound Name | N-(2,5-dimethylcyclopentyl)oxolan-3-amine |
|---|---|
| PubChem CID | 127013198 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | N-(2,5-dimethylcyclopentyl)oxolan-3-amine |
| SMILES | CC1CCC(C)C1NC1CCOC1 |
| InChI | InChI=1S/C11H21NO/c1-8-3-4-9(2)11(8)12-10-5-6-13-7-10/h8-12H,3-7H2,1-2H3 |
| InChIKey | BCYSLSSZJBVMNS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |