About 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol
3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol (PubChem CID 127013447) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol |
| PubChem CID | 127013447 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol |
| SMILES | OCCCc1cnc2nnnn2c1 |
| InChI | InChI=1S/C7H9N5O/c13-3-1-2-6-4-8-7-9-10-11-12(7)5-6/h4-5,13H,1-3H2 |
| InChIKey | RDTLOPFNCAFDPN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
The IUPAC name of 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol (CID 127013447) is 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol.
What is the SMILES notation for 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
The canonical SMILES for 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol is OCCCc1cnc2nnnn2c1.
What is the InChIKey of 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
The InChIKey is RDTLOPFNCAFDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c13-3-1-2-6-4-8-7-9-10-11-12(7)5-6/h4-5,13H,1-3H2.
What are the key properties of 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol?
3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol has a molecular weight of 179.18 g/mol, XLogP of -0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(tetrazolo[1,5-a]pyrimidin-6-yl)propan-1-ol is sourced from PubChem (CID 127013447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).