About 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole
2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole (PubChem CID 127014938) has the molecular formula C4H8N4O3S
and a molecular weight of 192.20 g/mol. Its IUPAC name is 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole.
Molecular Properties
| Compound Name | 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole |
| PubChem CID | 127014938 |
| Molecular Formula | C4H8N4O3S |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole |
| SMILES | NS(=O)(=O)NCc1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H8N4O3S/c5-12(10,11)7-2-3-1-6-4(9)8-3/h1,7H,2H2,(H2,5,10,11)(H2,6,8,9) |
| InChIKey | WWPCPDGRHLIKDM-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole?
The IUPAC name of 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole (CID 127014938) is 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole.
What is the SMILES notation for 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole?
The canonical SMILES for 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole is NS(=O)(=O)NCc1c[nH]c(=O)[nH]1.
What is the InChIKey of 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole?
The InChIKey is WWPCPDGRHLIKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O3S/c5-12(10,11)7-2-3-1-6-4(9)8-3/h1,7H,2H2,(H2,5,10,11)(H2,6,8,9).
What are the key properties of 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole?
2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole has a molecular weight of 192.20 g/mol, XLogP of -2.00, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4-[(sulfamoylamino)methyl]-1,3-dihydroimidazole is sourced from PubChem (CID 127014938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).