C6H11N5S — CID 127014953
1-amino-3-[2-(1H-pyrazol-4-yl)ethyl]thiourea (PubChem CID 127014953) has the molecular formula C6H11N5S and a molecular weight of 185.26 g/mol. Its IUPAC name is 1-amino-3-[2-(1H-pyrazol-4-yl)ethyl]thiourea.
| Compound Name | 1-amino-3-[2-(1H-pyrazol-4-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 127014953 |
| Molecular Formula | C6H11N5S |
| Molecular Weight | 185.26 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 1-amino-3-[2-(1H-pyrazol-4-yl)ethyl]thiourea |
| SMILES | NNC(=S)NCCc1cn[nH]c1 |
| InChI | InChI=1S/C6H11N5S/c7-11-6(12)8-2-1-5-3-9-10-4-5/h3-4H,1-2,7H2,(H,9,10)(H2,8,11,12) |
| InChIKey | VTKIXXMSGGXDPY-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.26 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|