C8ClF7 — CID 12701532
1-(1-chloro-2,2-difluoroethenyl)-2,3,4,5,6-pentafluorobenzene (PubChem CID 12701532) has the molecular formula C8ClF7 and a molecular weight of 264.53 g/mol. Its IUPAC name is 1-(1-chloro-2,2-difluoroethenyl)-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(1-chloro-2,2-difluoroethenyl)-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 12701532 |
| Molecular Formula | C8ClF7 |
| Molecular Weight | 264.53 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 1-(1-chloro-2,2-difluoroethenyl)-2,3,4,5,6-pentafluorobenzene |
| SMILES | FC(F)=C(Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8ClF7/c9-2(8(15)16)1-3(10)5(12)7(14)6(13)4(1)11 |
| InChIKey | RYFRHYFPVLKJOM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|