C9H16 — CID 12701549
(3aR,6aR)-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 12701549) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (3aR,6aR)-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | (3aR,6aR)-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 12701549 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (3aR,6aR)-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CC1C[C@H]2CCC[C@@H]2C1 |
| InChI | InChI=1S/C9H16/c1-7-5-8-3-2-4-9(8)6-7/h7-9H,2-6H2,1H3/t8-,9-/m1/s1 |
| InChIKey | OWJYQLKKWIHHLI-RKDXNWHRSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |