About N'-ethoxy-N'-methylpropane-1,3-diamine
N'-ethoxy-N'-methylpropane-1,3-diamine (PubChem CID 127017497) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is N'-ethoxy-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-ethoxy-N'-methylpropane-1,3-diamine |
| PubChem CID | 127017497 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | N'-ethoxy-N'-methylpropane-1,3-diamine |
| SMILES | CCON(C)CCCN |
| InChI | InChI=1S/C6H16N2O/c1-3-9-8(2)6-4-5-7/h3-7H2,1-2H3 |
| InChIKey | ZIVONPKRXZCELN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethoxy-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethoxy-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-ethoxy-N'-methylpropane-1,3-diamine (CID 127017497) is N'-ethoxy-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-ethoxy-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-ethoxy-N'-methylpropane-1,3-diamine is CCON(C)CCCN.
What is the InChIKey of N'-ethoxy-N'-methylpropane-1,3-diamine?
The InChIKey is ZIVONPKRXZCELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O/c1-3-9-8(2)6-4-5-7/h3-7H2,1-2H3.
What are the key properties of N'-ethoxy-N'-methylpropane-1,3-diamine?
N'-ethoxy-N'-methylpropane-1,3-diamine has a molecular weight of 132.21 g/mol, XLogP of 0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethoxy-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 127017497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).