About 4-methyl-5-propan-2-yl-1,3-dioxane
4-methyl-5-propan-2-yl-1,3-dioxane (PubChem CID 12701807) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 4-methyl-5-propan-2-yl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-methyl-5-propan-2-yl-1,3-dioxane |
| PubChem CID | 12701807 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 4-methyl-5-propan-2-yl-1,3-dioxane |
| SMILES | CC(C)C1COCOC1C |
| InChI | InChI=1S/C8H16O2/c1-6(2)8-4-9-5-10-7(8)3/h6-8H,4-5H2,1-3H3 |
| InChIKey | LJHJZPVNOFOZHL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-5-propan-2-yl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-propan-2-yl-1,3-dioxane?
The IUPAC name of 4-methyl-5-propan-2-yl-1,3-dioxane (CID 12701807) is 4-methyl-5-propan-2-yl-1,3-dioxane.
What is the SMILES notation for 4-methyl-5-propan-2-yl-1,3-dioxane?
The canonical SMILES for 4-methyl-5-propan-2-yl-1,3-dioxane is CC(C)C1COCOC1C.
What is the InChIKey of 4-methyl-5-propan-2-yl-1,3-dioxane?
The InChIKey is LJHJZPVNOFOZHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-6(2)8-4-9-5-10-7(8)3/h6-8H,4-5H2,1-3H3.
What are the key properties of 4-methyl-5-propan-2-yl-1,3-dioxane?
4-methyl-5-propan-2-yl-1,3-dioxane has a molecular weight of 144.21 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-propan-2-yl-1,3-dioxane is sourced from PubChem (CID 12701807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).