4-(hydroxyamino)pyrimidine-5-carboxylic acid

C5H5N3O3 — CID 127018723

IUPAC4-(hydroxyamino)pyrimidine-5-carboxylic acid
SMILESO=C(O)c1cncnc1NO
InChIInChI=1S/C5H5N3O3/c9-5(10)3-1-6-2-7-4(3)8-11/h1-2,11H,(H,9,10)(H,6,7,8)
InChIKeyACRMBTAQXNWKSX-UHFFFAOYSA-N
MW155.11 g/mol
LogP-0.02
Rot. Bonds2

About 4-(hydroxyamino)pyrimidine-5-carboxylic acid

4-(hydroxyamino)pyrimidine-5-carboxylic acid (PubChem CID 127018723) has the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. Its IUPAC name is 4-(hydroxyamino)pyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name4-(hydroxyamino)pyrimidine-5-carboxylic acid
PubChem CID127018723
Molecular FormulaC5H5N3O3
Molecular Weight155.11 g/mol
Exact Mass155.03
IUPAC Name4-(hydroxyamino)pyrimidine-5-carboxylic acid
SMILESO=C(O)c1cncnc1NO
InChIInChI=1S/C5H5N3O3/c9-5(10)3-1-6-2-7-4(3)8-11/h1-2,11H,(H,9,10)(H,6,7,8)
InChIKeyACRMBTAQXNWKSX-UHFFFAOYSA-N
XLogP-0.02
TPSA95.34 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.11
LogP ≤ 5-0.02
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(hydroxyamino)pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(2-methylpropylamino)pyrimidine-5-carboxylic acid
CID 28905979
4-[(2-methylcyclopropyl)amino]pyrimidine-5-carboxylic acid
CID 130484563
4-(2-fluoroanilino)pyrimidine-5-carboxylic acid
CID 28906049
4-(3-tricyclo[3.2.1.02,4]octanylamino)pyrimidine-5-carboxylic acid
CID 114214807
4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]pyrimidine-5-carboxylic acid
CID 114214902
4-(3-chloroanilino)pyrimidine-5-carboxylic acid
CID 28906082
4-(2,5-difluoroanilino)pyrimidine-5-carboxylic acid
CID 115148846
4-[[3-(diethylamino)-3-oxopropyl]amino]pyrimidine-5-carboxylic acid
CID 114214618
4-[2-[methyl(methylsulfonyl)amino]ethylamino]pyrimidine-5-carboxylic acid
CID 72891695
4-(4-fluoro-3-methylanilino)pyrimidine-5-carboxylic acid
CID 115148840
4-[(1-ethylcyclopentyl)methylamino]pyrimidine-5-carboxylic acid
CID 114214842
4-(2-bromo-4-fluoroanilino)pyrimidine-5-carboxylic acid
CID 114214052

Frequently Asked Questions

What is the IUPAC name of 4-(hydroxyamino)pyrimidine-5-carboxylic acid?
The IUPAC name of 4-(hydroxyamino)pyrimidine-5-carboxylic acid (CID 127018723) is 4-(hydroxyamino)pyrimidine-5-carboxylic acid.
What is the SMILES notation for 4-(hydroxyamino)pyrimidine-5-carboxylic acid?
The canonical SMILES for 4-(hydroxyamino)pyrimidine-5-carboxylic acid is O=C(O)c1cncnc1NO.
What is the InChIKey of 4-(hydroxyamino)pyrimidine-5-carboxylic acid?
The InChIKey is ACRMBTAQXNWKSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O3/c9-5(10)3-1-6-2-7-4(3)8-11/h1-2,11H,(H,9,10)(H,6,7,8).
What are the key properties of 4-(hydroxyamino)pyrimidine-5-carboxylic acid?
4-(hydroxyamino)pyrimidine-5-carboxylic acid has a molecular weight of 155.11 g/mol, XLogP of -0.02, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxyamino)pyrimidine-5-carboxylic acid is sourced from PubChem (CID 127018723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).