About 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one
1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one (PubChem CID 12701924) has the molecular formula C12H10ClNO2
and a molecular weight of 235.67 g/mol. Its IUPAC name is 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one.
Molecular Properties
| Compound Name | 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one |
| PubChem CID | 12701924 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one |
| SMILES | CC(=O)N1c2ccc(Cl)cc2C(=O)C12CC2 |
| InChI | InChI=1S/C12H10ClNO2/c1-7(15)14-10-3-2-8(13)6-9(10)11(16)12(14)4-5-12/h2-3,6H,4-5H2,1H3 |
| InChIKey | MPLMBPNRNPJURA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one?
The IUPAC name of 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one (CID 12701924) is 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one.
What is the SMILES notation for 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one?
The canonical SMILES for 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one is CC(=O)N1c2ccc(Cl)cc2C(=O)C12CC2.
What is the InChIKey of 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one?
The InChIKey is MPLMBPNRNPJURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO2/c1-7(15)14-10-3-2-8(13)6-9(10)11(16)12(14)4-5-12/h2-3,6H,4-5H2,1H3.
What are the key properties of 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one?
1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one has a molecular weight of 235.67 g/mol, XLogP of 2.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-acetyl-5'-chlorospiro[cyclopropane-1,2'-indole]-3'-one is sourced from PubChem (CID 12701924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).