About 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid
2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid (PubChem CID 127020420) has the molecular formula C8H9F2N3O2
and a molecular weight of 217.18 g/mol. Its IUPAC name is 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid.
Analyze 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid?
The IUPAC name of 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid (CID 127020420) is 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid.
What is the SMILES notation for 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid?
The canonical SMILES for 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid is CC(Nc1ncc(C(=O)O)cn1)C(F)F.
What is the InChIKey of 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid?
The InChIKey is OVKJPHVGLAJDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N3O2/c1-4(6(9)10)13-8-11-2-5(3-12-8)7(14)15/h2-4,6H,1H3,(H,14,15)(H,11,12,13).
What are the key properties of 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid?
2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid has a molecular weight of 217.18 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoropropan-2-ylamino)pyrimidine-5-carboxylic acid is sourced from PubChem (CID 127020420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).