C9H8N2O3S — CID 127020702
2-[but-2-ynoyl(methyl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 127020702) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-[but-2-ynoyl(methyl)amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[but-2-ynoyl(methyl)amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 127020702 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-[but-2-ynoyl(methyl)amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC#CC(=O)N(C)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C9H8N2O3S/c1-3-4-7(12)11(2)9-10-6(5-15-9)8(13)14/h5H,1-2H3,(H,13,14) |
| InChIKey | ACVYXOALMDKFNB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|