2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid

C5H3Cl2NO3 — CID 127020814

IUPAC2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C(Cl)Cl)o1
InChIInChI=1S/C5H3Cl2NO3/c6-3(7)4-8-1-2(11-4)5(9)10/h1,3H,(H,9,10)
InChIKeyHFUKZJVILAFBDB-UHFFFAOYSA-N
MW195.99 g/mol
LogP1.85
Rot. Bonds2

About 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid

2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 127020814) has the molecular formula C5H3Cl2NO3 and a molecular weight of 195.99 g/mol. Its IUPAC name is 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid
PubChem CID127020814
Molecular FormulaC5H3Cl2NO3
Molecular Weight195.99 g/mol
Exact Mass194.95
IUPAC Name2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid
SMILESO=C(O)c1cnc(C(Cl)Cl)o1
InChIInChI=1S/C5H3Cl2NO3/c6-3(7)4-8-1-2(11-4)5(9)10/h1,3H,(H,9,10)
InChIKeyHFUKZJVILAFBDB-UHFFFAOYSA-N
XLogP1.85
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.99
LogP ≤ 51.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid (CID 127020814) is 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid is O=C(O)c1cnc(C(Cl)Cl)o1.
What is the InChIKey of 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is HFUKZJVILAFBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2NO3/c6-3(7)4-8-1-2(11-4)5(9)10/h1,3H,(H,9,10).
What are the key properties of 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid?
2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 195.99 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 127020814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).