C35H48N4O3 — CID 127021019
4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-(quinolin-2-ylmethoxy)phenyl]propan-2-yl]cyclohexane-1-carboxamide (PubChem CID 127021019) has the molecular formula C35H48N4O3 and a molecular weight of 572.79 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-(quinolin-2-ylmethoxy)phenyl]propan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-(quinolin-2-ylmethoxy)phenyl]propan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 127021019 |
| Molecular Formula | C35H48N4O3 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | 4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-(quinolin-2-ylmethoxy)phenyl]propan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)[C@H](Cc1ccc(OCc2ccc3ccccc3n2)cc1)NC(=O)C1CCC(CN)CC1 |
| InChI | InChI=1S/C35H48N4O3/c1-2-3-4-5-6-9-22-37-35(41)33(39-34(40)29-16-12-27(24-36)13-17-29)23-26-14-20-31(21-15-26)42-25-30-19-18-28-10-7-8-11-32(28)38-30/h7-8,10-11,14-15,18-21,27,29,33H,2-6,9,12-13,16-17,22-25,36H2,1H3,(H,37,41)(H,39,40)/t27?,29?,33-/m0/s1 |
| InChIKey | ZGUNTZKJIWJKEH-JSJPEOMGSA-N |
| XLogP | 6.08 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|