C18H25N5 — CID 127021126
(3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 127021126) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is (3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 127021126 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | (3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(pyridin-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1C(Cn2cccn2)C[C@@H]2CN(Cc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C18H25N5/c1-21-17(14-23-8-3-7-20-23)10-16-13-22(9-5-18(16)21)12-15-4-2-6-19-11-15/h2-4,6-8,11,16-18H,5,9-10,12-14H2,1H3/t16-,17?,18+/m1/s1 |
| InChIKey | SIFFBJDSUQGYJC-BLAYRMRBSA-N |
| XLogP | 1.87 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |