C18H27N5O — CID 127021127
1-[(3aR,7aS)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanone (PubChem CID 127021127) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is 1-[(3aR,7aS)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanone.
| Compound Name | 1-[(3aR,7aS)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanone |
|---|---|
| PubChem CID | 127021127 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | 1-[(3aR,7aS)-4-(4-pyrimidin-2-ylpiperazin-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2CCCC(N3CCN(c4ncccn4)CC3)[C@H]2C1 |
| InChI | InChI=1S/C18H27N5O/c1-14(24)23-12-15-4-2-5-17(16(15)13-23)21-8-10-22(11-9-21)18-19-6-3-7-20-18/h3,6-7,15-17H,2,4-5,8-13H2,1H3/t15-,16+,17?/m1/s1 |
| InChIKey | FFILFIVGRGWHOF-GARXDOFDSA-N |
| XLogP | 1.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |