C18H21N3O2S — CID 127021141
[(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 127021141) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is [(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 127021141 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(3aR,7aS)-4-(pyridin-3-ylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1C[C@H]2CCCC(OCc3cccnc3)[C@H]2C1 |
| InChI | InChI=1S/C18H21N3O2S/c22-18(16-11-24-12-20-16)21-8-14-4-1-5-17(15(14)9-21)23-10-13-3-2-6-19-7-13/h2-3,6-7,11-12,14-15,17H,1,4-5,8-10H2/t14-,15+,17?/m1/s1 |
| InChIKey | XCZALUZJNABWLC-CKDQBVIESA-N |
| XLogP | 3.00 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |