C23H24F7N3O5 — CID 127021316
(7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021316) has the molecular formula C23H24F7N3O5 and a molecular weight of 555.45 g/mol. Its IUPAC name is (7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021316 |
| Molecular Formula | C23H24F7N3O5 |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | (7R,8aS)-7-(3-fluorophenoxy)-2-(pyridin-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Fc1cccc(O[C@@H]2C[C@H]3CN(Cc4ccccn4)CCN3C2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H22FN3O.2C2HF3O2/c20-15-4-3-6-18(10-15)24-19-11-17-13-22(8-9-23(17)14-19)12-16-5-1-2-7-21-16;2*3-2(4,5)1(6)7/h1-7,10,17,19H,8-9,11-14H2;2*(H,6,7)/t17-,19+;;/m0../s1 |
| InChIKey | BFXWOLMKGCOXIO-UKWJXJBFSA-N |
| XLogP | 3.82 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |