C22H29F6N5O6 — CID 127021320
[(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021320) has the molecular formula C22H29F6N5O6 and a molecular weight of 573.49 g/mol. Its IUPAC name is [(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021320 |
| Molecular Formula | C22H29F6N5O6 |
| Molecular Weight | 573.49 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | [(3S,3aR,7aR)-3-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrazin-2-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCN(C[C@H]2OC[C@@H]3CCN(C(=O)c4cnccn4)C[C@@H]32)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N5O2.2C2HF3O2/c1-21-6-8-22(9-7-21)12-17-15-11-23(5-2-14(15)13-25-17)18(24)16-10-19-3-4-20-16;2*3-2(4,5)1(6)7/h3-4,10,14-15,17H,2,5-9,11-13H2,1H3;2*(H,6,7)/t14-,15-,17+;;/m0../s1 |
| InChIKey | KYGOLXDDMDFXBY-QGHPEMKXSA-N |
| XLogP | 1.47 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |