C21H30F6N4O5 — CID 127021350
(5aS,8aS)-7-cyclopentyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021350) has the molecular formula C21H30F6N4O5 and a molecular weight of 532.48 g/mol. Its IUPAC name is (5aS,8aS)-7-cyclopentyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (5aS,8aS)-7-cyclopentyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021350 |
| Molecular Formula | C21H30F6N4O5 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (5aS,8aS)-7-cyclopentyl-4-[(1-methylpyrazol-4-yl)methyl]-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CCO[C@@H]3CN(C4CCCC4)C[C@@H]3C2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N4O.2C2HF3O2/c1-19-9-14(8-18-19)10-20-6-7-22-17-13-21(12-15(17)11-20)16-4-2-3-5-16;2*3-2(4,5)1(6)7/h8-9,15-17H,2-7,10-13H2,1H3;2*(H,6,7)/t15-,17+;;/m0../s1 |
| InChIKey | NBUMJWGZOLAFKH-WUGUAYAESA-N |
| XLogP | 2.76 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |