About (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride
(2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride (PubChem CID 127021371) has the molecular formula C18H22Cl2N2
and a molecular weight of 337.29 g/mol. Its IUPAC name is (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride |
| PubChem CID | 127021371 |
| Molecular Formula | C18H22Cl2N2 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride |
| SMILES | Cl.Clc1cccc(N[C@H]2CCCN[C@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H21ClN2.ClH/c19-15-8-4-9-16(13-15)21-17-10-5-11-20-18(17)12-14-6-2-1-3-7-14;/h1-4,6-9,13,17-18,20-21H,5,10-12H2;1H/t17-,18-;/m0./s1 |
| InChIKey | ZKSUATJGATUSCA-APTPAJQOSA-N |
| XLogP | 4.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride?
The IUPAC name of (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride (CID 127021371) is (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride.
What is the SMILES notation for (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride?
The canonical SMILES for (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride is Cl.Clc1cccc(N[C@H]2CCCN[C@H]2Cc2ccccc2)c1.
What is the InChIKey of (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride?
The InChIKey is ZKSUATJGATUSCA-APTPAJQOSA-N. The full InChI is InChI=1S/C18H21ClN2.ClH/c19-15-8-4-9-16(13-15)21-17-10-5-11-20-18(17)12-14-6-2-1-3-7-14;/h1-4,6-9,13,17-18,20-21H,5,10-12H2;1H/t17-,18-;/m0./s1.
What are the key properties of (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride?
(2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride has a molecular weight of 337.29 g/mol, XLogP of 4.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-benzyl-N-(3-chlorophenyl)piperidin-3-amine;hydrochloride is sourced from PubChem (CID 127021371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).