C17H21F4NO4 — CID 127021399
(4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 127021399) has the molecular formula C17H21F4NO4 and a molecular weight of 379.35 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021399 |
| Molecular Formula | C17H21F4NO4 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (4aS,7R,7aR)-4-[(4-fluorophenyl)methyl]-7-methoxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1CC[C@H]2[C@H]1OCCN2Cc1ccc(F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H20FNO2.C2HF3O2/c1-18-14-7-6-13-15(14)19-9-8-17(13)10-11-2-4-12(16)5-3-11;3-2(4,5)1(6)7/h2-5,13-15H,6-10H2,1H3;(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | FLCSRMITOUCUHE-ONAKXNSWSA-N |
| XLogP | 2.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |