C20H26F4N2O4 — CID 127021407
(4R,4aR,9aR)-7-[(4-fluorophenyl)methyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydro-2H-pyrido[3,4-d]azepin-1-one;2,2,2-trifluoroacetic acid (PubChem CID 127021407) has the molecular formula C20H26F4N2O4 and a molecular weight of 434.43 g/mol. Its IUPAC name is (4R,4aR,9aR)-7-[(4-fluorophenyl)methyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydro-2H-pyrido[3,4-d]azepin-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aR,9aR)-7-[(4-fluorophenyl)methyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydro-2H-pyrido[3,4-d]azepin-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021407 |
| Molecular Formula | C20H26F4N2O4 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (4R,4aR,9aR)-7-[(4-fluorophenyl)methyl]-4-(methoxymethyl)-3,4,4a,5,6,8,9,9a-octahydro-2H-pyrido[3,4-d]azepin-1-one;2,2,2-trifluoroacetic acid |
| SMILES | COC[C@H]1CNC(=O)[C@@H]2CCN(Cc3ccc(F)cc3)CC[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25FN2O2.C2HF3O2/c1-23-12-14-10-20-18(22)17-7-9-21(8-6-16(14)17)11-13-2-4-15(19)5-3-13;3-2(4,5)1(6)7/h2-5,14,16-17H,6-12H2,1H3,(H,20,22);(H,6,7)/t14-,16-,17-;/m1./s1 |
| InChIKey | IUGOGVWJFZAAHU-XJEXWWMKSA-N |
| XLogP | 2.68 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |