C20H22F3N3O4S — CID 127021417
[(2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrrol-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127021417) has the molecular formula C20H22F3N3O4S and a molecular weight of 457.47 g/mol. Its IUPAC name is [(2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrrol-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrrol-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021417 |
| Molecular Formula | C20H22F3N3O4S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [(2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrrol-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cccc1C(=O)N1C[C@@H]2C[C@@H](c3nc(C4CC4)cs3)O[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3O2S.C2HF3O2/c1-20-6-2-3-14(20)18(22)21-8-12-7-15(23-16(12)9-21)17-19-13(10-24-17)11-4-5-11;3-2(4,5)1(6)7/h2-3,6,10-12,15-16H,4-5,7-9H2,1H3;(H,6,7)/t12-,15-,16+;/m0./s1 |
| InChIKey | IJVBRPMHUSRKRW-RXAPEJBRSA-N |
| XLogP | 3.59 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |