C19H26F3N3O5S — CID 127021599
ethyl (3aS,8aR)-2-acetyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 127021599) has the molecular formula C19H26F3N3O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is ethyl (3aS,8aR)-2-acetyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl (3aS,8aR)-2-acetyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021599 |
| Molecular Formula | C19H26F3N3O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | ethyl (3aS,8aR)-2-acetyl-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,8-hexahydro-1H-pyrrolo[3,4-c]azepine-8a-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)[C@]12CCCN(Cc3nccs3)C[C@H]1CN(C(C)=O)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3S.C2HF3O2/c1-3-23-16(22)17-5-4-7-19(11-15-18-6-8-24-15)9-14(17)10-20(12-17)13(2)21;3-2(4,5)1(6)7/h6,8,14H,3-5,7,9-12H2,1-2H3;(H,6,7)/t14-,17-;/m0./s1 |
| InChIKey | KDSJGJBQLABYSD-RVXRQPKJSA-N |
| XLogP | 2.40 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |