C22H35ClN2OS — CID 127021695
1-[(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one;hydrochloride (PubChem CID 127021695) has the molecular formula C22H35ClN2OS and a molecular weight of 411.06 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one;hydrochloride.
| Compound Name | 1-[(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 127021695 |
| Molecular Formula | C22H35ClN2OS |
| Molecular Weight | 411.06 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-[(3S,3aS,7aR)-5-cyclohexyl-3-thiophen-3-yl-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-1-yl]-2,2-dimethylpropan-1-one;hydrochloride |
| SMILES | CC(C)(C)C(=O)N1C[C@H](c2ccsc2)[C@H]2CN(C3CCCCC3)CC[C@H]21.Cl |
| InChI | InChI=1S/C22H34N2OS.ClH/c1-22(2,3)21(25)24-14-18(16-10-12-26-15-16)19-13-23(11-9-20(19)24)17-7-5-4-6-8-17;/h10,12,15,17-20H,4-9,11,13-14H2,1-3H3;1H/t18-,19-,20-;/m1./s1 |
| InChIKey | OGPNCWSPFAMVEC-DEXIKXDTSA-N |
| XLogP | 5.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.06 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |