C19H25F3N4O5 — CID 127021712
2-[[(4aS,7R,7aR)-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 127021712) has the molecular formula C19H25F3N4O5 and a molecular weight of 446.43 g/mol. Its IUPAC name is 2-[[(4aS,7R,7aR)-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(4aS,7R,7aR)-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021712 |
| Molecular Formula | C19H25F3N4O5 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[[(4aS,7R,7aR)-4-pyrimidin-2-yl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-1-pyrrolidin-1-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CO[C@@H]1CC[C@H]2[C@H]1OCCN2c1ncccn1)N1CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O3.C2HF3O2/c22-15(20-8-1-2-9-20)12-24-14-5-4-13-16(14)23-11-10-21(13)17-18-6-3-7-19-17;3-2(4,5)1(6)7/h3,6-7,13-14,16H,1-2,4-5,8-12H2;(H,6,7)/t13-,14+,16+;/m0./s1 |
| InChIKey | NGPQQSKKPFPHRB-YJUBXGJFSA-N |
| XLogP | 1.49 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |