C18H24F3N3O5S — CID 127021741
[(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127021741) has the molecular formula C18H24F3N3O5S and a molecular weight of 451.47 g/mol. Its IUPAC name is [(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021741 |
| Molecular Formula | C18H24F3N3O5S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [(3aR,5R,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-5-yl]-(oxazinan-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@H]1CC[C@@H]2[C@@H](CCN2Cc2nccs2)O1)N1CCCCO1 |
| InChI | InChI=1S/C16H23N3O3S.C2HF3O2/c20-16(19-7-1-2-9-21-19)14-4-3-12-13(22-14)5-8-18(12)11-15-17-6-10-23-15;3-2(4,5)1(6)7/h6,10,12-14H,1-5,7-9,11H2;(H,6,7)/t12-,13-,14-;/m1./s1 |
| InChIKey | SONGFXDTRPTRFC-MBLYYGPHSA-N |
| XLogP | 2.45 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |