C15H19F5N2O3 — CID 127021780
4-[[(3aS,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid (PubChem CID 127021780) has the molecular formula C15H19F5N2O3 and a molecular weight of 370.32 g/mol. Its IUPAC name is 4-[[(3aS,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(3aS,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021780 |
| Molecular Formula | C15H19F5N2O3 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-[[(3aS,6aR)-5,5-difluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-3,5-dimethyl-1,2-oxazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1noc(C)c1CN1C[C@@H]2CC(F)(F)C[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H18F2N2O.C2HF3O2/c1-8-12(9(2)18-16-8)7-17-5-10-3-13(14,15)4-11(10)6-17;3-2(4,5)1(6)7/h10-11H,3-7H2,1-2H3;(H,6,7)/t10-,11+; |
| InChIKey | DHFQVZLFQKIIHP-NJJJQDLFSA-N |
| XLogP | 3.40 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |