C20H28F3NO5 — CID 127021786
(4aS,7R,7aR)-7-ethoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 127021786) has the molecular formula C20H28F3NO5 and a molecular weight of 419.44 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-ethoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7R,7aR)-7-ethoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021786 |
| Molecular Formula | C20H28F3NO5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (4aS,7R,7aR)-7-ethoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | CCO[C@@H]1CC[C@H]2[C@H]1OCCN2CCOCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27NO3.C2HF3O2/c1-2-21-17-9-8-16-18(17)22-13-11-19(16)10-12-20-14-15-6-4-3-5-7-15;3-2(4,5)1(6)7/h3-7,16-18H,2,8-14H2,1H3;(H,6,7)/t16-,17+,18+;/m0./s1 |
| InChIKey | FNRQIQLQVVBBJP-QQBJDQAASA-N |
| XLogP | 3.10 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|