C19H26F3NO5 — CID 127021789
(4aS,7S,7aR)-7-methoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid (PubChem CID 127021789) has the molecular formula C19H26F3NO5 and a molecular weight of 405.41 g/mol. Its IUPAC name is (4aS,7S,7aR)-7-methoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,7S,7aR)-7-methoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021789 |
| Molecular Formula | C19H26F3NO5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (4aS,7S,7aR)-7-methoxy-4-(2-phenylmethoxyethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@H]1CC[C@H]2[C@H]1OCCN2CCOCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25NO3.C2HF3O2/c1-19-16-8-7-15-17(16)21-12-10-18(15)9-11-20-13-14-5-3-2-4-6-14;3-2(4,5)1(6)7/h2-6,15-17H,7-13H2,1H3;(H,6,7)/t15-,16-,17+;/m0./s1 |
| InChIKey | HVUPDPAPTGGJIX-JDFMPCBTSA-N |
| XLogP | 2.71 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|