C16H23F3N2O3S — CID 127021793
4-[[(3aR,7aS)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 127021793) has the molecular formula C16H23F3N2O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[[(3aR,7aS)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(3aR,7aS)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021793 |
| Molecular Formula | C16H23F3N2O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-[[(3aR,7aS)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | COC1CCC[C@@H]2CN(Cc3csc(C)n3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N2OS.C2HF3O2/c1-10-15-12(9-18-10)7-16-6-11-4-3-5-14(17-2)13(11)8-16;3-2(4,5)1(6)7/h9,11,13-14H,3-8H2,1-2H3;(H,6,7)/t11-,13+,14?;/m1./s1 |
| InChIKey | ZLLNOIFYQIILHH-AKYFCJFGSA-N |
| XLogP | 3.33 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |