C16H23F3N4O4 — CID 127021794
N-[[(1R,3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1-methylimidazole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127021794) has the molecular formula C16H23F3N4O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-[[(1R,3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1-methylimidazole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(1R,3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1-methylimidazole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021794 |
| Molecular Formula | C16H23F3N4O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[[(1R,3aR,7aR)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-1-yl]methyl]-1-methylimidazole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CC[C@@H]2[C@@H](CO[C@H]2CNC(=O)c2nccn2C)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O2.C2HF3O2/c1-17-5-3-11-10(8-17)9-20-12(11)7-16-14(19)13-15-4-6-18(13)2;3-2(4,5)1(6)7/h4,6,10-12H,3,5,7-9H2,1-2H3,(H,16,19);(H,6,7)/t10-,11-,12+;/m1./s1 |
| InChIKey | STPFCELUVLOQJF-HSASPSRMSA-N |
| XLogP | 0.75 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |