C18H23F7N4O5 — CID 127021817
(4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021817) has the molecular formula C18H23F7N4O5 and a molecular weight of 508.39 g/mol. Its IUPAC name is (4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021817 |
| Molecular Formula | C18H23F7N4O5 |
| Molecular Weight | 508.39 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (4R,4aS,7aS)-6-ethyl-1-(5-fluoropyrimidin-2-yl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1C[C@H]2[C@@H](C1)N(c1ncc(F)cn1)CC[C@H]2OC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21FN4O.2C2HF3O2/c1-3-18-8-11-12(9-18)19(5-4-13(11)20-2)14-16-6-10(15)7-17-14;2*3-2(4,5)1(6)7/h6-7,11-13H,3-5,8-9H2,1-2H3;2*(H,6,7)/t11-,12+,13+;;/m0../s1 |
| InChIKey | JDNGMHLOZBBHDV-QDDWCWDGSA-N |
| XLogP | 2.43 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |