C16H17F3N4O4S2 — CID 127021856
(3aR,6aS)-1-pyrimidin-2-yl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127021856) has the molecular formula C16H17F3N4O4S2 and a molecular weight of 450.46 g/mol. Its IUPAC name is (3aR,6aS)-1-pyrimidin-2-yl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-1-pyrimidin-2-yl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021856 |
| Molecular Formula | C16H17F3N4O4S2 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | (3aR,6aS)-1-pyrimidin-2-yl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(c1cccs1)N1CC[C@H]2[C@H]1CCN2c1ncccn1 |
| InChI | InChI=1S/C14H16N4O2S2.C2HF3O2/c19-22(20,13-3-1-10-21-13)18-9-5-11-12(18)4-8-17(11)14-15-6-2-7-16-14;3-2(4,5)1(6)7/h1-3,6-7,10-12H,4-5,8-9H2;(H,6,7)/t11-,12+;/m0./s1 |
| InChIKey | OKYLTTOWGNMKFX-ZVWHLABXSA-N |
| XLogP | 2.21 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |