C17H20F3N3O4S2 — CID 127021902
(3S,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127021902) has the molecular formula C17H20F3N3O4S2 and a molecular weight of 451.49 g/mol. Its IUPAC name is (3S,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021902 |
| Molecular Formula | C17H20F3N3O4S2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (3S,3aR,6aS)-3-[(2-methyl-1,3-thiazol-4-yl)methoxy]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CO[C@@H]2CN(Cc3nccs3)[C@@H]3COC[C@@H]32)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N3O2S2.C2HF3O2/c1-10-17-11(9-22-10)6-20-14-4-18(5-15-16-2-3-21-15)13-8-19-7-12(13)14;3-2(4,5)1(6)7/h2-3,9,12-14H,4-8H2,1H3;(H,6,7)/t12-,13+,14+;/m0./s1 |
| InChIKey | DXLHYURRYNMGDC-SOIKFHLCSA-N |
| XLogP | 2.96 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |