C17H20F4N4O4 — CID 127021916
(3aR,5R,7aR)-N-cyclopropyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127021916) has the molecular formula C17H20F4N4O4 and a molecular weight of 420.36 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-cyclopropyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N-cyclopropyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021916 |
| Molecular Formula | C17H20F4N4O4 |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (3aR,5R,7aR)-N-cyclopropyl-1-(5-fluoropyrimidin-2-yl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC1CC1)[C@H]1CC[C@@H]2[C@@H](CCN2c2ncc(F)cn2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19FN4O2.C2HF3O2/c16-9-7-17-15(18-8-9)20-6-5-12-11(20)3-4-13(22-12)14(21)19-10-1-2-10;3-2(4,5)1(6)7/h7-8,10-13H,1-6H2,(H,19,21);(H,6,7)/t11-,12-,13-;/m1./s1 |
| InChIKey | NBTRTEOGCOYBEC-NLPVPVDASA-N |
| XLogP | 1.65 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |