C19H23F3N4O4S — CID 127021963
(3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127021963) has the molecular formula C19H23F3N4O4S and a molecular weight of 460.48 g/mol. Its IUPAC name is (3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021963 |
| Molecular Formula | C19H23F3N4O4S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (3aS,5S,7aS)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1-pyrimidin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COC[C@@H]2CC[C@H]3[C@H](CCN3c3ncccn3)O2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N4O2S.C2HF3O2/c1-12-20-13(11-24-12)9-22-10-14-3-4-15-16(23-14)5-8-21(15)17-18-6-2-7-19-17;3-2(4,5)1(6)7/h2,6-7,11,14-16H,3-5,8-10H2,1H3;(H,6,7)/t14-,15-,16-;/m0./s1 |
| InChIKey | MPKWSFHEDBJIBT-NLQWVURJSA-N |
| XLogP | 3.22 |
| TPSA | 97.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |