C20H27F6N3O7S — CID 127021985
(3aS,4R,7aS)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021985) has the molecular formula C20H27F6N3O7S and a molecular weight of 567.51 g/mol. Its IUPAC name is (3aS,4R,7aS)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,4R,7aS)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021985 |
| Molecular Formula | C20H27F6N3O7S |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | (3aS,4R,7aS)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCNC(=O)[C@H]1CN(Cc2csc(C)n2)C[C@H]2OCC[C@@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O3S.2C2HF3O2/c1-11-18-12(10-23-11)7-19-8-14(16(20)17-4-6-21-2)13-3-5-22-15(13)9-19;2*3-2(4,5)1(6)7/h10,13-15H,3-9H2,1-2H3,(H,17,20);2*(H,6,7)/t13-,14-,15+;;/m0../s1 |
| InChIKey | XZAXVTLTFHEFCL-DPJDSMRSSA-N |
| XLogP | 2.32 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|