About (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride
(2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride (PubChem CID 127022016) has the molecular formula C18H23Cl3N2
and a molecular weight of 373.75 g/mol. Its IUPAC name is (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride |
| PubChem CID | 127022016 |
| Molecular Formula | C18H23Cl3N2 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cccc(C[C@@H]2NCCC[C@@H]2Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H21ClN2.2ClH/c19-15-7-4-6-14(12-15)13-18-17(10-5-11-20-18)21-16-8-2-1-3-9-16;;/h1-4,6-9,12,17-18,20-21H,5,10-11,13H2;2*1H/t17-,18-;;/m0../s1 |
| InChIKey | IBCLJICYOJXHFF-MPGISEFESA-N |
| XLogP | 4.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride?
The IUPAC name of (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride (CID 127022016) is (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride.
What is the SMILES notation for (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride?
The canonical SMILES for (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride is Cl.Cl.Clc1cccc(C[C@@H]2NCCC[C@@H]2Nc2ccccc2)c1.
What is the InChIKey of (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride?
The InChIKey is IBCLJICYOJXHFF-MPGISEFESA-N. The full InChI is InChI=1S/C18H21ClN2.2ClH/c19-15-7-4-6-14(12-15)13-18-17(10-5-11-20-18)21-16-8-2-1-3-9-16;;/h1-4,6-9,12,17-18,20-21H,5,10-11,13H2;2*1H/t17-,18-;;/m0../s1.
What are the key properties of (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride?
(2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride has a molecular weight of 373.75 g/mol, XLogP of 4.96, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-[(3-chlorophenyl)methyl]-N-phenylpiperidin-3-amine;dihydrochloride is sourced from PubChem (CID 127022016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).