C20H21F3N4O4 — CID 127022030
[(5aR,8aS)-7-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 127022030) has the molecular formula C20H21F3N4O4 and a molecular weight of 438.41 g/mol. Its IUPAC name is [(5aR,8aS)-7-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(5aR,8aS)-7-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022030 |
| Molecular Formula | C20H21F3N4O4 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [(5aR,8aS)-7-pyrimidin-2-yl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-phenylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccccc1)N1CCO[C@@H]2CN(c3ncccn3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H20N4O2.C2HF3O2/c23-17(14-5-2-1-3-6-14)21-9-10-24-16-13-22(12-15(16)11-21)18-19-7-4-8-20-18;3-2(4,5)1(6)7/h1-8,15-16H,9-13H2;(H,6,7)/t15-,16+;/m0./s1 |
| InChIKey | JWBDBGOQXNZWQZ-IDVLALEDSA-N |
| XLogP | 2.09 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |