C18H18F4N4O3S — CID 127022088
(2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127022088) has the molecular formula C18H18F4N4O3S and a molecular weight of 446.43 g/mol. Its IUPAC name is (2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022088 |
| Molecular Formula | C18H18F4N4O3S |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | (2S,3aS,6aS)-2-(4-cyclopropyl-1,3-thiazol-2-yl)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Fc1cnc(N2C[C@@H]3C[C@@H](c4nc(C5CC5)cs4)O[C@@H]3C2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H17FN4OS.C2HF3O2/c17-11-4-18-16(19-5-11)21-6-10-3-13(22-14(10)7-21)15-20-12(8-23-15)9-1-2-9;3-2(4,5)1(6)7/h4-5,8-10,13-14H,1-3,6-7H2;(H,6,7)/t10-,13-,14+;/m0./s1 |
| InChIKey | RZLWISFKEBOKMP-FRHHKCRJSA-N |
| XLogP | 3.55 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |