C17H22F3N3O4S — CID 127022091
[(3aS,6aR)-1-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 127022091) has the molecular formula C17H22F3N3O4S and a molecular weight of 421.44 g/mol. Its IUPAC name is [(3aS,6aR)-1-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aS,6aR)-1-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022091 |
| Molecular Formula | C17H22F3N3O4S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [(3aS,6aR)-1-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cscn1)N1CC[C@@H]2[C@@H]1CCN2C1CCOCC1 |
| InChI | InChI=1S/C15H21N3O2S.C2HF3O2/c19-15(12-9-21-10-16-12)18-6-2-13-14(18)1-5-17(13)11-3-7-20-8-4-11;3-2(4,5)1(6)7/h9-11,13-14H,1-8H2;(H,6,7)/t13-,14+;/m1./s1 |
| InChIKey | MJPLRWFOOFSQGY-DFQHDRSWSA-N |
| XLogP | 2.24 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |