C21H29F3N2O5 — CID 127022114
(2R,3aS,7aR)-N-(2-methoxyethyl)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022114) has the molecular formula C21H29F3N2O5 and a molecular weight of 446.47 g/mol. Its IUPAC name is (2R,3aS,7aR)-N-(2-methoxyethyl)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,7aR)-N-(2-methoxyethyl)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022114 |
| Molecular Formula | C21H29F3N2O5 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2R,3aS,7aR)-N-(2-methoxyethyl)-6-(2-phenylethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@H]1C[C@@H]2CCN(CCc3ccccc3)C[C@@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H28N2O3.C2HF3O2/c1-23-12-9-20-19(22)17-13-16-8-11-21(14-18(16)24-17)10-7-15-5-3-2-4-6-15;3-2(4,5)1(6)7/h2-6,16-18H,7-14H2,1H3,(H,20,22);(H,6,7)/t16-,17+,18-;/m0./s1 |
| InChIKey | YSAHJLZIOHDMAQ-RXQQAGQTSA-N |
| XLogP | 2.10 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|