C20H26F6N4O6 — CID 127022152
(3aR,5R,7aR)-N-cyclopropyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127022152) has the molecular formula C20H26F6N4O6 and a molecular weight of 532.44 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-cyclopropyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,5R,7aR)-N-cyclopropyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127022152 |
| Molecular Formula | C20H26F6N4O6 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | (3aR,5R,7aR)-N-cyclopropyl-1-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CC[C@H]3O[C@@H](C(=O)NC4CC4)CC[C@H]32)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2.2C2HF3O2/c1-19-9-11(8-17-19)10-20-7-6-14-13(20)4-5-15(22-14)16(21)18-12-2-3-12;2*3-2(4,5)1(6)7/h8-9,12-15H,2-7,10H2,1H3,(H,18,21);2*(H,6,7)/t13-,14-,15-;;/m1../s1 |
| InChIKey | GOEGQYCIUXBXGH-CRCLDWEMSA-N |
| XLogP | 2.09 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |