C13H17F3N2O3S — CID 127022208
(2R,3aS,6aS)-2-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127022208) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is (2R,3aS,6aS)-2-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,6aS)-2-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022208 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2R,3aS,6aS)-2-methyl-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@H]1C[C@H]2CN(Cc3nccs3)C[C@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H16N2OS.C2HF3O2/c1-8-4-9-5-13(6-10(9)14-8)7-11-12-2-3-15-11;3-2(4,5)1(6)7/h2-3,8-10H,4-7H2,1H3;(H,6,7)/t8-,9+,10-;/m1./s1 |
| InChIKey | ASHQCDURBFPTQL-YMQJAAJZSA-N |
| XLogP | 2.39 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |