C16H16F4N4O3S — CID 127022259
(2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127022259) has the molecular formula C16H16F4N4O3S and a molecular weight of 420.39 g/mol. Its IUPAC name is (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022259 |
| Molecular Formula | C16H16F4N4O3S |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (2S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2-(4-methyl-1,3-thiazol-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1csc([C@@H]2C[C@H]3CN(c4ncc(F)cn4)C[C@H]3O2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H15FN4OS.C2HF3O2/c1-8-7-21-13(18-8)11-2-9-5-19(6-12(9)20-11)14-16-3-10(15)4-17-14;3-2(4,5)1(6)7/h3-4,7,9,11-12H,2,5-6H2,1H3;(H,6,7)/t9-,11-,12+;/m0./s1 |
| InChIKey | LBMRBYGDHINVKN-NUZGNSGISA-N |
| XLogP | 2.98 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |