C18H22F4N4O5 — CID 127022368
[(3aR,7R,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 127022368) has the molecular formula C18H22F4N4O5 and a molecular weight of 450.39 g/mol. Its IUPAC name is [(3aR,7R,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,7R,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022368 |
| Molecular Formula | C18H22F4N4O5 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [(3aR,7R,7aR)-2-(5-fluoropyrimidin-2-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C([C@H]1COC[C@H]2CN(c3ncc(F)cn3)C[C@H]21)N1CCOCC1 |
| InChI | InChI=1S/C16H21FN4O3.C2HF3O2/c17-12-5-18-16(19-6-12)21-7-11-9-24-10-14(13(11)8-21)15(22)20-1-3-23-4-2-20;3-2(4,5)1(6)7/h5-6,11,13-14H,1-4,7-10H2;(H,6,7)/t11-,13-,14+;/m1./s1 |
| InChIKey | SPLKYMMKMCITMK-DSNOOMGLSA-N |
| XLogP | 0.81 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |