C21H31F3N2O4S — CID 127022385
4-[[(3aS,6aS)-2-(oxan-4-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 127022385) has the molecular formula C21H31F3N2O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 4-[[(3aS,6aS)-2-(oxan-4-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(3aS,6aS)-2-(oxan-4-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022385 |
| Molecular Formula | C21H31F3N2O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-[[(3aS,6aS)-2-(oxan-4-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COC[C@@]23CCC[C@@H]2CN(CC2CCOCC2)C3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N2O2S.C2HF3O2/c1-15-20-18(12-24-15)11-23-14-19-6-2-3-17(19)10-21(13-19)9-16-4-7-22-8-5-16;3-2(4,5)1(6)7/h12,16-17H,2-11,13-14H2,1H3;(H,6,7)/t17-,19+;/m1./s1 |
| InChIKey | XERRNXDKPGWELQ-ZFNKBKEPSA-N |
| XLogP | 4.13 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |